Hippuristanol

| ChEMBL = 1098427 | StdInChI_Ref = | StdInChI = 1S/C28H46O5/c1-15-13-28(33-24(15,2)3)27(6,31)23-21(32-28)12-19-18-8-7-16-11-17(29)9-10-25(16,4)22(18)20(30)14-26(19,23)5/h15-23,29-31H,7-14H2,1-6H3/t15-,16-,17+,18-,19-,20-,21-,22+,23-,25-,26-,27+,28+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = HPHXKNOXVBFETI-SHCCRYCOSA-N | SMILES1 = OC(C(=O)NNCNC(=O)c1ccccc1)(c2ccccc2)c3ccccc3 | InChI = 1S/C28H46O5/c1-15-13-28(33-24(15,2)3)27(6,31)23-21(32-28)12-19-18-8-7-16-11-17(29)9-10-25(16,4)22(18)20(30)14-26(19,23)5/h15-23,29-31H,7-14H2,1-6H3/t15-,16-,17+,18-,19-,20-,21-,22+,23-,25-,26-,27+,28+/m0/s1 | InChIKey1 = HPHXKNOXVBFETI-SHCCRYCOSA-N | CASNo_Ref = | CASNo=80442-78-0 | PubChem=5205637 | ChemSpiderID_Ref = | ChemSpiderID=21105576 | SMILES=[H][C@@]23CC[C@@]1([H])C[C@H](O)CC[C@@](C)1[C@]([H])2[C@@H](O)C[C@@]4(C)[C@@](C[C@@]5([H])[C@@]([H])4[C@](O)(C)[C@]6(C[C@H](C)C(C)(C)O6)O5)3[H] }} |Section2= |Section3= }}

Hippuristanol is a small molecule found in the coral ''Isis hippuris'' which was discovered by Jerry Pelletier and others of McGill University in Montreal, Quebec, Canada. It appears to have anti-viral activity and may hold promise as a cancer therapy. Binds to and inhibits the eukaryotic translation initiation factor protein eIF4A. Provided by Wikipedia
Showing 1 - 4 results of 4 for search 'Jerry Pelletier', query time: 0.04s Refine Results
  1. 1
  2. 2
  3. 3
  4. 4