Saudin

| ChemSpiderID = 5293122 | PubChem = 6917902 | UNII_Ref = | UNII = 9X6I4D5FVQ | StdInChI=1S/C20H22O7/c1-11-13-8-18(12-4-7-23-9-12)26-19-10-24-15(22)16(19,2)5-6-20(27-18,17(13,19)3)25-14(11)21/h4,7,9,11,13H,5-6,8,10H2,1-3H3/t11-,13?,16-,17-,18-,19-,20+/m1/s1 | StdInChIKey = MIZCOUBLUGPQEO-UHMNIBCTSA-N | SMILES = C[C@@H]1C2C[C@@]3(O[C@@]4([C@]2([C@@]5(O3)COC(=O)[C@]5(CC4)C)C)OC1=O)C6=COC=C6}} |Section2= |Section3= }}

Saudin is a diterpenoid first isolated from the African flowering plant ''Cluytia richardiana''.

Saudin has shown a hypoglycemic effect in an rodent model experiment.

Because of the unusual chemical structure and its potential biological activity, there has been research aimed at its total synthesis. Provided by Wikipedia
Showing 1 - 17 results of 17 for search 'Saudin', query time: 0.05s Refine Results
  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17