Saudin

| ChemSpiderID = 5293122 | PubChem = 6917902 | UNII_Ref = | UNII = 9X6I4D5FVQ | StdInChI=1S/C20H22O7/c1-11-13-8-18(12-4-7-23-9-12)26-19-10-24-15(22)16(19,2)5-6-20(27-18,17(13,19)3)25-14(11)21/h4,7,9,11,13H,5-6,8,10H2,1-3H3/t11-,13?,16-,17-,18-,19-,20+/m1/s1 | StdInChIKey = MIZCOUBLUGPQEO-UHMNIBCTSA-N | SMILES = C[C@@H]1C2C[C@@]3(O[C@@]4([C@]2([C@@]5(O3)COC(=O)[C@]5(CC4)C)C)OC1=O)C6=COC=C6}} |Section2= |Section3= }}

Saudin is a diterpenoid first isolated from the African flowering plant ''Cluytia richardiana''.

Saudin has shown a hypoglycemic effect in an rodent model experiment.

Because of the unusual chemical structure and its potential biological activity, there has been research aimed at its total synthesis. Provided by Wikipedia