Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2
C36H26Cu2N4O9, monoclinic, P121/c1 (no. 14), a = 13.732(3) Å, b = 17.188(3) Å, c = 14.127(3) Å, β = 104.57(3)°, V = 3227.1 Å3, Z = 4, Rgt(F) = 0.032, wRref(F2) = 0.089, T = 293 K.
| Main Author: | |
|---|---|
| Format: | Article |
| Language: | English |
| Published: |
De Gruyter
2006-09-01
|
| Series: | Zeitschrift für Kristallographie - New Crystal Structures |
| Online Access: | https://doi.org/10.1524/ncrs.2006.0121 |
| _version_ | 1811247504870604800 |
|---|---|
| author | Wang C.-C. |
| author_facet | Wang C.-C. |
| author_sort | Wang C.-C. |
| collection | DOAJ |
| description | C36H26Cu2N4O9, monoclinic, P121/c1 (no. 14), a = 13.732(3) Å, b = 17.188(3) Å, c = 14.127(3) Å, β = 104.57(3)°, V = 3227.1 Å3, Z = 4, Rgt(F) = 0.032, wRref(F2) = 0.089, T = 293 K. |
| first_indexed | 2024-04-12T15:10:56Z |
| format | Article |
| id | doaj.art-68b664115b114a958e746d8c80e38e44 |
| institution | Directory Open Access Journal |
| issn | 1433-7266 2197-4578 |
| language | English |
| last_indexed | 2024-04-12T15:10:56Z |
| publishDate | 2006-09-01 |
| publisher | De Gruyter |
| record_format | Article |
| series | Zeitschrift für Kristallographie - New Crystal Structures |
| spelling | doaj.art-68b664115b114a958e746d8c80e38e442022-12-22T03:27:46ZengDe GruyterZeitschrift für Kristallographie - New Crystal Structures1433-72662197-45782006-09-01221338538710.1524/ncrs.2006.0121Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2Wang C.-C.0Beijing Institute of Civil Engineering and Architecture, Department of Urban Construction Engineering, Beijing 100044, P. R. ChinaC36H26Cu2N4O9, monoclinic, P121/c1 (no. 14), a = 13.732(3) Å, b = 17.188(3) Å, c = 14.127(3) Å, β = 104.57(3)°, V = 3227.1 Å3, Z = 4, Rgt(F) = 0.032, wRref(F2) = 0.089, T = 293 K.https://doi.org/10.1524/ncrs.2006.0121 |
| spellingShingle | Wang C.-C. Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2 Zeitschrift für Kristallographie - New Crystal Structures |
| title | Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2 |
| title_full | Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2 |
| title_fullStr | Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2 |
| title_full_unstemmed | Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2 |
| title_short | Refinement of the crystal structure of aquabis(2,2′-bipyridine)- bis(terephtalato)dicopper(II), Cu2(H2O)(C10H8N2)2(C8H4O4)2 |
| title_sort | refinement of the crystal structure of aquabis 2 2 bipyridine bis terephtalato dicopper ii cu2 h2o c10h8n2 2 c8h4o4 2 |
| url | https://doi.org/10.1524/ncrs.2006.0121 |
| work_keys_str_mv | AT wangcc refinementofthecrystalstructureofaquabis22bipyridinebisterephtalatodicopperiicu2h2oc10h8n22c8h4o42 |